What is the name for C2F4?

Published by Charlie Davidson on

What is the name for C2F4?

IUPAC Name 1,1,2,2-tetrafluoroethene
Alternative Names Tetrafluoroethene TETRAFLUOROETHYLENE Perfluoroethylene Perfluoroethene
Molecular Formula C2F4
Molar Mass 100.016 g/mol
InChI InChI=1S/C2F4/c3-1(4)2(5)6

What is C2F4 used for?

The main use of tetrafluoroethylene is in the manufacture of polytetrafluoroethylene that is used as nonstick coatings on cookware, membranes for clothing that are both waterproof and breathable, electrical-wire casing, fire- and chemical-resistant tubing, and plumbing thread seal tape.

What was TFE?

Tetrafluoroethylene (TFE) is a fluorocarbon with the chemical formula C2F4. It is the simplest perfluorinated alkene. This gaseous species is used primarily in the industrial preparation of fluoropolymers.

How do you make tetrafluoroethylene?

Tetrafluoroethylene is produced by heating chlorodifluoromethane, which is made from chloroform by its reaction with hydrogen fluoride in the presence of antimony pentachloride; chlorodifluoromethane (known by several trade names, of which the oldest is Freon 22) is used as a refrigerant in small air conditioners.

Which plastic is also called Teflon?

polytetrafluoroethylene
Teflon is a synthetic polymer containing carbon and fluorine called polytetrafluoroethylene. That’s right, Teflon is PTFE but by another name.

What are natural monomers called?

Nucleotides are the monomers of natural, linear polymer nucleic acids such as deoxyribonucleic acid (DNA) and ribonucleic acid (RNA).

What does PTFE stand for?

polytetrafluoroethylene (PTFE), a strong, tough, waxy, nonflammable synthetic resin produced by the polymerization of tetrafluoroethylene.

What is the difference between TFE and PTFE?

Tetrafluoroetheylene, also referred to as TFE, is a synthetic fluoropolymer more commonly known as Teflon®. Teflon® is the broader material while FEP, PTFE, and ETFE are subsets of Teflon®. TFE can withstand very high and low temperatures, is extremely durable and exhibits excellent electrical properties.

What is the structure of tetrafluoroethylene?

C2F4
Tetrafluoroethylene/Formula

Why is Tetrafluoroethene inert?

However, instead of reactive C-H bonds which occur in most polymers, Teflon has all its hydrogens replaced by fluorines. These strong C-F bonds are extremely resistant to attack by any other reagents, making Teflon very inert. This means that no other molecules will react with or stick to Teflon.

What is the full form of PTFE?

Polytetrafluoroethylene (PTFE) is a synthetic fluoropolymer of tetrafluoroethylene. Being hydrophobic, non-wetting, high density and resistant to high temperatures, PTFE is an incredibly versatile material with a wide variety of applications, though it’s perhaps best-known for its non-stick properties.

What is the chemical formula for carbon tetrafluoride?

Carbon tetrafluoride PubChem CID 6393 Structure Find Similar Structures Chemical Safety Laboratory Chemical Safety Summary (LCSS Molecular Formula CF4 Synonyms CARBON TETRAFLUORIDE Tetrafluoromethane

How is CF4 used in the semiconductor industry?

IDENTIFICATION AND USE: Tetrafluoromethane (CF4) is a colorless odorless gas. It is used as low temperature refrigerant; gaseous insulator. It is also used for plasma etching of silicon wafers in the semiconductor industry. HUMAN EXPOSURE AND TOXICITY: It can cause confusion, headache by inhalation.

How is chlorodifluoromethane used in a nuclear reactor?

Steam, preheated to 1220 K, and chlorodifluoromethane, at 670 K, are fed into a reactor. Steam is used to dilute the reaction mixture and hence reduce the reactant partial pressure, and thus the formation of carbon and toxic by-products.

How is trichloromethane reacted with anhydrous hydrogen fluoride?

Trichloromethane is reacted with anhydrous hydrogen fluoride in the presence of antimony (III) and antimony (V) chlorofluoride to give chlorodifluoromethane:

Categories: Contributing